C19H19ClF2N2O4 — CID 9217161
N-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 9217161) has the molecular formula C19H19ClF2N2O4 and a molecular weight of 412.82 g/mol. Its IUPAC name is N-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 9217161 |
| Molecular Formula | C19H19ClF2N2O4 |
| Molecular Weight | 412.82 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NCCc2ccc(Cl)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C19H19ClF2N2O4/c1-27-16-10-13(4-7-15(16)28-19(21)22)18(26)24-11-17(25)23-9-8-12-2-5-14(20)6-3-12/h2-7,10,19H,8-9,11H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | GJZMRSYAFNOPFS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |