C17H15ClF2N2O4 — CID 9412072
N-[2-(3-chloroanilino)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 9412072) has the molecular formula C17H15ClF2N2O4 and a molecular weight of 384.77 g/mol. Its IUPAC name is N-[2-(3-chloroanilino)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-[2-(3-chloroanilino)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 9412072 |
| Molecular Formula | C17H15ClF2N2O4 |
| Molecular Weight | 384.77 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-[2-(3-chloroanilino)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)Nc2cccc(Cl)c2)ccc1OC(F)F |
| InChI | InChI=1S/C17H15ClF2N2O4/c1-25-14-7-10(5-6-13(14)26-17(19)20)16(24)21-9-15(23)22-12-4-2-3-11(18)8-12/h2-8,17H,9H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | NYIZDFYEXAVUJO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |