C18H17ClF2N2O4 — CID 26533075
N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 26533075) has the molecular formula C18H17ClF2N2O4 and a molecular weight of 398.79 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 26533075 |
| Molecular Formula | C18H17ClF2N2O4 |
| Molecular Weight | 398.79 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NCc2ccc(Cl)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H17ClF2N2O4/c1-26-15-8-12(4-7-14(15)27-18(20)21)17(25)23-10-16(24)22-9-11-2-5-13(19)6-3-11/h2-8,18H,9-10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | GAWGZQSKRICUGE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.79 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |