C18H17F3N2O4 — CID 17480128
N-[2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-2-oxoethyl]-4-fluorobenzamide (PubChem CID 17480128) has the molecular formula C18H17F3N2O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is N-[2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-2-oxoethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-2-oxoethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 17480128 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-[2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-2-oxoethyl]-4-fluorobenzamide |
| SMILES | COc1cc(CNC(=O)CNC(=O)c2ccc(F)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H17F3N2O4/c1-26-15-8-11(2-7-14(15)27-18(20)21)9-22-16(24)10-23-17(25)12-3-5-13(19)6-4-12/h2-8,18H,9-10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ARYNKCZIHHTEOP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |