C19H19F4NO5 — CID 9261772
4-(difluoromethoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-ethoxybenzamide (PubChem CID 9261772) has the molecular formula C19H19F4NO5 and a molecular weight of 417.36 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-ethoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-ethoxybenzamide |
|---|---|
| PubChem CID | 9261772 |
| Molecular Formula | C19H19F4NO5 |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 4-(difluoromethoxy)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-ethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCc2ccc(OC(F)F)c(OC)c2)ccc1OC(F)F |
| InChI | InChI=1S/C19H19F4NO5/c1-3-27-16-9-12(5-7-14(16)29-19(22)23)17(25)24-10-11-4-6-13(28-18(20)21)15(8-11)26-2/h4-9,18-19H,3,10H2,1-2H3,(H,24,25) |
| InChIKey | SYTZDOQPCPRIFK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |