C17H15F2N3O3 — CID 17424349
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3H-benzimidazole-5-carboxamide (PubChem CID 17424349) has the molecular formula C17H15F2N3O3 and a molecular weight of 347.32 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 17424349 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3H-benzimidazole-5-carboxamide |
| SMILES | COc1cc(CNC(=O)c2ccc3nc[nH]c3c2)ccc1OC(F)F |
| InChI | InChI=1S/C17H15F2N3O3/c1-24-15-6-10(2-5-14(15)25-17(18)19)8-20-16(23)11-3-4-12-13(7-11)22-9-21-12/h2-7,9,17H,8H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | ZEVWUFSIHLKQSK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |