C19H21F2NO5 — CID 9246064
4-(difluoromethoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methoxybenzamide (PubChem CID 9246064) has the molecular formula C19H21F2NO5 and a molecular weight of 381.38 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 9246064 |
| Molecular Formula | C19H21F2NO5 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-(difluoromethoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methoxybenzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(OC(F)F)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H21F2NO5/c1-24-14-6-4-12(10-16(14)25-2)8-9-22-18(23)13-5-7-15(27-19(20)21)17(11-13)26-3/h4-7,10-11,19H,8-9H2,1-3H3,(H,22,23) |
| InChIKey | BCFDLSBHLQJJJV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |