C11H13F2NO4 — CID 78783270
4-(difluoromethoxy)-N-(2-hydroxyethyl)-3-methoxybenzamide (PubChem CID 78783270) has the molecular formula C11H13F2NO4 and a molecular weight of 261.22 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(2-hydroxyethyl)-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-(2-hydroxyethyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 78783270 |
| Molecular Formula | C11H13F2NO4 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-(difluoromethoxy)-N-(2-hydroxyethyl)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCO)ccc1OC(F)F |
| InChI | InChI=1S/C11H13F2NO4/c1-17-9-6-7(10(16)14-4-5-15)2-3-8(9)18-11(12)13/h2-3,6,11,15H,4-5H2,1H3,(H,14,16) |
| InChIKey | QXGLUCAOJIRPOD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |