C14H17F2NO5 — CID 119234202
5-[[3-(difluoromethoxy)-4-methoxybenzoyl]amino]pentanoic acid (PubChem CID 119234202) has the molecular formula C14H17F2NO5 and a molecular weight of 317.29 g/mol. Its IUPAC name is 5-[[3-(difluoromethoxy)-4-methoxybenzoyl]amino]pentanoic acid.
| Compound Name | 5-[[3-(difluoromethoxy)-4-methoxybenzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234202 |
| Molecular Formula | C14H17F2NO5 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 5-[[3-(difluoromethoxy)-4-methoxybenzoyl]amino]pentanoic acid |
| SMILES | COc1ccc(C(=O)NCCCCC(=O)O)cc1OC(F)F |
| InChI | InChI=1S/C14H17F2NO5/c1-21-10-6-5-9(8-11(10)22-14(15)16)13(20)17-7-3-2-4-12(18)19/h5-6,8,14H,2-4,7H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | ZYBARNVKFYJFEZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|