C14H17F2NO6 — CID 119352935
4-[[4-(difluoromethoxy)-3,5-dimethoxybenzoyl]amino]butanoic acid (PubChem CID 119352935) has the molecular formula C14H17F2NO6 and a molecular weight of 333.29 g/mol. Its IUPAC name is 4-[[4-(difluoromethoxy)-3,5-dimethoxybenzoyl]amino]butanoic acid.
| Compound Name | 4-[[4-(difluoromethoxy)-3,5-dimethoxybenzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119352935 |
| Molecular Formula | C14H17F2NO6 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-[[4-(difluoromethoxy)-3,5-dimethoxybenzoyl]amino]butanoic acid |
| SMILES | COc1cc(C(=O)NCCCC(=O)O)cc(OC)c1OC(F)F |
| InChI | InChI=1S/C14H17F2NO6/c1-21-9-6-8(13(20)17-5-3-4-11(18)19)7-10(22-2)12(9)23-14(15)16/h6-7,14H,3-5H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | NHUTXKMVGWOKQG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|