C17H24ClNO5 — CID 119234484
5-[[3-chloro-5-methoxy-4-(2-methylpropoxy)benzoyl]amino]pentanoic acid (PubChem CID 119234484) has the molecular formula C17H24ClNO5 and a molecular weight of 357.83 g/mol. Its IUPAC name is 5-[[3-chloro-5-methoxy-4-(2-methylpropoxy)benzoyl]amino]pentanoic acid.
| Compound Name | 5-[[3-chloro-5-methoxy-4-(2-methylpropoxy)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234484 |
| Molecular Formula | C17H24ClNO5 |
| Molecular Weight | 357.83 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 5-[[3-chloro-5-methoxy-4-(2-methylpropoxy)benzoyl]amino]pentanoic acid |
| SMILES | COc1cc(C(=O)NCCCCC(=O)O)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C17H24ClNO5/c1-11(2)10-24-16-13(18)8-12(9-14(16)23-3)17(22)19-7-5-4-6-15(20)21/h8-9,11H,4-7,10H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | KWJSUBBCHLCLEF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.83 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|