C18H27ClN2O4 — CID 41276636
N-[2-(tert-butylamino)-2-oxoethyl]-3-chloro-5-methoxy-4-(2-methylpropoxy)benzamide (PubChem CID 41276636) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-3-chloro-5-methoxy-4-(2-methylpropoxy)benzamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-3-chloro-5-methoxy-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 41276636 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-3-chloro-5-methoxy-4-(2-methylpropoxy)benzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NC(C)(C)C)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C18H27ClN2O4/c1-11(2)10-25-16-13(19)7-12(8-14(16)24-6)17(23)20-9-15(22)21-18(3,4)5/h7-8,11H,9-10H2,1-6H3,(H,20,23)(H,21,22) |
| InChIKey | RDUKUFKUVUVNDC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |