C16H23ClN2O4 — CID 26457001
N-[2-(tert-butylamino)-2-oxoethyl]-3-chloro-4-ethoxy-5-methoxybenzamide (PubChem CID 26457001) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-3-chloro-4-ethoxy-5-methoxybenzamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-3-chloro-4-ethoxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 26457001 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-3-chloro-4-ethoxy-5-methoxybenzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)NCC(=O)NC(C)(C)C)cc1OC |
| InChI | InChI=1S/C16H23ClN2O4/c1-6-23-14-11(17)7-10(8-12(14)22-5)15(21)18-9-13(20)19-16(2,3)4/h7-8H,6,9H2,1-5H3,(H,18,21)(H,19,20) |
| InChIKey | AMFRIOIOFOVVNV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |