C21H26ClNO6 — CID 55709358
3-chloro-4-ethoxy-5-methoxy-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide (PubChem CID 55709358) has the molecular formula C21H26ClNO6 and a molecular weight of 423.89 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55709358 |
| Molecular Formula | C21H26ClNO6 |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)NC(C)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H26ClNO6/c1-7-29-19-15(22)8-14(11-16(19)25-3)21(24)23-12(2)13-9-17(26-4)20(28-6)18(10-13)27-5/h8-12H,7H2,1-6H3,(H,23,24) |
| InChIKey | LWJPAYBFMZTGAZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |