C17H19ClN2O3 — CID 43007006
3-chloro-4-ethoxy-5-methoxy-N-(1-pyridin-2-ylethyl)benzamide (PubChem CID 43007006) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N-(1-pyridin-2-ylethyl)benzamide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N-(1-pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 43007006 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N-(1-pyridin-2-ylethyl)benzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)NC(C)c2ccccn2)cc1OC |
| InChI | InChI=1S/C17H19ClN2O3/c1-4-23-16-13(18)9-12(10-15(16)22-3)17(21)20-11(2)14-7-5-6-8-19-14/h5-11H,4H2,1-3H3,(H,20,21) |
| InChIKey | PHPZBLURWDLOSD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |