C17H17BrClNO3 — CID 43059210
N-[1-(3-bromophenyl)ethyl]-3-chloro-4,5-dimethoxybenzamide (PubChem CID 43059210) has the molecular formula C17H17BrClNO3 and a molecular weight of 398.68 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethyl]-3-chloro-4,5-dimethoxybenzamide.
| Compound Name | N-[1-(3-bromophenyl)ethyl]-3-chloro-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 43059210 |
| Molecular Formula | C17H17BrClNO3 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | N-[1-(3-bromophenyl)ethyl]-3-chloro-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(C)c2cccc(Br)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C17H17BrClNO3/c1-10(11-5-4-6-13(18)7-11)20-17(21)12-8-14(19)16(23-3)15(9-12)22-2/h4-10H,1-3H3,(H,20,21) |
| InChIKey | IPIDTSSKNATLKX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |