C15H22ClNO4 — CID 71848078
3-chloro-4-ethoxy-N-(3-hydroxypentyl)-5-methoxybenzamide (PubChem CID 71848078) has the molecular formula C15H22ClNO4 and a molecular weight of 315.80 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-N-(3-hydroxypentyl)-5-methoxybenzamide.
| Compound Name | 3-chloro-4-ethoxy-N-(3-hydroxypentyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 71848078 |
| Molecular Formula | C15H22ClNO4 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 3-chloro-4-ethoxy-N-(3-hydroxypentyl)-5-methoxybenzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)NCCC(O)CC)cc1OC |
| InChI | InChI=1S/C15H22ClNO4/c1-4-11(18)6-7-17-15(19)10-8-12(16)14(21-5-2)13(9-10)20-3/h8-9,11,18H,4-7H2,1-3H3,(H,17,19) |
| InChIKey | BTJQXMCCSQFKKM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |