C15H23NO5 — CID 115703422
N-(3-hydroxypentyl)-3,4,5-trimethoxybenzamide (PubChem CID 115703422) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-(3-hydroxypentyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(3-hydroxypentyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 115703422 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-(3-hydroxypentyl)-3,4,5-trimethoxybenzamide |
| SMILES | CCC(O)CCNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H23NO5/c1-5-11(17)6-7-16-15(18)10-8-12(19-2)14(21-4)13(9-10)20-3/h8-9,11,17H,5-7H2,1-4H3,(H,16,18) |
| InChIKey | CIQZQKMXJZOVBF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |