C18H28N2O5 — CID 108538157
N-[2-(2-ethylbutanoylamino)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 108538157) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[2-(2-ethylbutanoylamino)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(2-ethylbutanoylamino)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 108538157 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-[2-(2-ethylbutanoylamino)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCC(CC)C(=O)NCCNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H28N2O5/c1-6-12(7-2)17(21)19-8-9-20-18(22)13-10-14(23-3)16(25-5)15(11-13)24-4/h10-12H,6-9H2,1-5H3,(H,19,21)(H,20,22) |
| InChIKey | FWVPWBJRMYRNAA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|