C15H25N2O4+ — CID 2315963
dimethyl-[3-[(3,4,5-trimethoxybenzoyl)amino]propyl]azanium (PubChem CID 2315963) has the molecular formula C15H25N2O4+ and a molecular weight of 297.38 g/mol. Its IUPAC name is dimethyl-[3-[(3,4,5-trimethoxybenzoyl)amino]propyl]azanium.
| Compound Name | dimethyl-[3-[(3,4,5-trimethoxybenzoyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 2315963 |
| Molecular Formula | C15H25N2O4+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | dimethyl-[3-[(3,4,5-trimethoxybenzoyl)amino]propyl]azanium |
| SMILES | COc1cc(C(=O)NCCC[NH+](C)C)cc(OC)c1OC |
| InChI | InChI=1S/C15H24N2O4/c1-17(2)8-6-7-16-15(18)11-9-12(19-3)14(21-5)13(10-11)20-4/h9-10H,6-8H2,1-5H3,(H,16,18)/p+1 |
| InChIKey | ZKPDTRSZIILDMM-UHFFFAOYSA-O |
| XLogP | -0.02 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|