C18H32N4O2+2 — CID 2164611
3-[[4-[3-(dimethylazaniumyl)propylcarbamoyl]benzoyl]amino]propyl-dimethylazanium (PubChem CID 2164611) has the molecular formula C18H32N4O2+2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 3-[[4-[3-(dimethylazaniumyl)propylcarbamoyl]benzoyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[4-[3-(dimethylazaniumyl)propylcarbamoyl]benzoyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 2164611 |
| Molecular Formula | C18H32N4O2+2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 3-[[4-[3-(dimethylazaniumyl)propylcarbamoyl]benzoyl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNC(=O)c1ccc(C(=O)NCCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C18H30N4O2/c1-21(2)13-5-11-19-17(23)15-7-9-16(10-8-15)18(24)20-12-6-14-22(3)4/h7-10H,5-6,11-14H2,1-4H3,(H,19,23)(H,20,24)/p+2 |
| InChIKey | TWQXVDLVPAWZGC-UHFFFAOYSA-P |
| XLogP | -1.78 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|