C20H27N2O+ — CID 7029075
diethyl-[3-[(4-phenylbenzoyl)amino]propyl]azanium (PubChem CID 7029075) has the molecular formula C20H27N2O+ and a molecular weight of 311.45 g/mol. Its IUPAC name is diethyl-[3-[(4-phenylbenzoyl)amino]propyl]azanium.
| Compound Name | diethyl-[3-[(4-phenylbenzoyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 7029075 |
| Molecular Formula | C20H27N2O+ |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | diethyl-[3-[(4-phenylbenzoyl)amino]propyl]azanium |
| SMILES | CC[NH+](CC)CCCNC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O/c1-3-22(4-2)16-8-15-21-20(23)19-13-11-18(12-14-19)17-9-6-5-7-10-17/h5-7,9-14H,3-4,8,15-16H2,1-2H3,(H,21,23)/p+1 |
| InChIKey | VCNQOEOESSSEOA-UHFFFAOYSA-O |
| XLogP | 2.40 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|