C14H21Cl3N2O — CID 20787024
3-[(3,5-dichlorobenzoyl)amino]propyl-diethylazanium chloride (PubChem CID 20787024) has the molecular formula C14H21Cl3N2O and a molecular weight of 339.69 g/mol. Its IUPAC name is 3-[(3,5-dichlorobenzoyl)amino]propyl-diethylazanium chloride.
| Compound Name | 3-[(3,5-dichlorobenzoyl)amino]propyl-diethylazanium chloride |
|---|---|
| PubChem CID | 20787024 |
| Molecular Formula | C14H21Cl3N2O |
| Molecular Weight | 339.69 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-[(3,5-dichlorobenzoyl)amino]propyl-diethylazanium chloride |
| SMILES | CC[NH+](CC)CCCNC(=O)c1cc(Cl)cc(Cl)c1.[Cl-] |
| InChI | InChI=1S/C14H20Cl2N2O.ClH/c1-3-18(4-2)7-5-6-17-14(19)11-8-12(15)10-13(16)9-11;/h8-10H,3-7H2,1-2H3,(H,17,19);1H |
| InChIKey | NPIHRYBJCJYGKD-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.69 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|