C23H23NO3S — CID 55842064
N-(3-benzylsulfonylpropyl)-4-phenylbenzamide (PubChem CID 55842064) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-4-phenylbenzamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 55842064 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-4-phenylbenzamide |
| SMILES | O=C(NCCCS(=O)(=O)Cc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO3S/c25-23(22-14-12-21(13-15-22)20-10-5-2-6-11-20)24-16-7-17-28(26,27)18-19-8-3-1-4-9-19/h1-6,8-15H,7,16-18H2,(H,24,25) |
| InChIKey | RNYQOHOMMJNVAK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|