C14H19NO5S — CID 166191912
[2-(3-benzylsulfonylpropylamino)-2-oxoethyl] acetate (PubChem CID 166191912) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is [2-(3-benzylsulfonylpropylamino)-2-oxoethyl] acetate.
| Compound Name | [2-(3-benzylsulfonylpropylamino)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 166191912 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [2-(3-benzylsulfonylpropylamino)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO5S/c1-12(16)20-10-14(17)15-8-5-9-21(18,19)11-13-6-3-2-4-7-13/h2-4,6-7H,5,8-11H2,1H3,(H,15,17) |
| InChIKey | HVMDQMMJKHBCLR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|