C20H22N2O3S — CID 47029588
N-(3-benzylsulfonylpropyl)-2-(1H-indol-3-yl)acetamide (PubChem CID 47029588) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 47029588 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-2-(1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O3S/c23-20(13-17-14-22-19-10-5-4-9-18(17)19)21-11-6-12-26(24,25)15-16-7-2-1-3-8-16/h1-5,7-10,14,22H,6,11-13,15H2,(H,21,23) |
| InChIKey | NNYNCCCXTAZALG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|