C21H26N6O3S — CID 42439707
2-(1H-indol-3-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropyl]acetamide (PubChem CID 42439707) has the molecular formula C21H26N6O3S and a molecular weight of 442.55 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropyl]acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropyl]acetamide |
|---|---|
| PubChem CID | 42439707 |
| Molecular Formula | C21H26N6O3S |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropyl]acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NCCCS(=O)(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H26N6O3S/c28-20(15-17-16-25-19-6-2-1-5-18(17)19)22-9-4-14-31(29,30)27-12-10-26(11-13-27)21-23-7-3-8-24-21/h1-3,5-8,16,25H,4,9-15H2,(H,22,28) |
| InChIKey | IJEINXWFCWUMHZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|