C17H23N3O3S — CID 71932055
N-[2-(cyclobutylmethylsulfamoyl)ethyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 71932055) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[2-(cyclobutylmethylsulfamoyl)ethyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(cyclobutylmethylsulfamoyl)ethyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 71932055 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[2-(cyclobutylmethylsulfamoyl)ethyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NCCS(=O)(=O)NCC1CCC1 |
| InChI | InChI=1S/C17H23N3O3S/c21-17(10-14-12-19-16-7-2-1-6-15(14)16)18-8-9-24(22,23)20-11-13-4-3-5-13/h1-2,6-7,12-13,19-20H,3-5,8-11H2,(H,18,21) |
| InChIKey | IHPJZBCGXKBFBO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |