C17H21N3O2 — CID 112990882
N-[2-(cyclopentylamino)-2-oxoethyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 112990882) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[2-(cyclopentylamino)-2-oxoethyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(cyclopentylamino)-2-oxoethyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 112990882 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[2-(cyclopentylamino)-2-oxoethyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H21N3O2/c21-16(19-11-17(22)20-13-5-1-2-6-13)9-12-10-18-15-8-4-3-7-14(12)15/h3-4,7-8,10,13,18H,1-2,5-6,9,11H2,(H,19,21)(H,20,22) |
| InChIKey | PWAXLEYNPMKQHJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |