C19H26N2O — CID 140983117
N-cyclohexyl-5-(1H-indol-3-yl)pentanamide (PubChem CID 140983117) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N-cyclohexyl-5-(1H-indol-3-yl)pentanamide.
| Compound Name | N-cyclohexyl-5-(1H-indol-3-yl)pentanamide |
|---|---|
| PubChem CID | 140983117 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-cyclohexyl-5-(1H-indol-3-yl)pentanamide |
| SMILES | O=C(CCCCc1c[nH]c2ccccc12)NC1CCCCC1 |
| InChI | InChI=1S/C19H26N2O/c22-19(21-16-9-2-1-3-10-16)13-7-4-8-15-14-20-18-12-6-5-11-17(15)18/h5-6,11-12,14,16,20H,1-4,7-10,13H2,(H,21,22) |
| InChIKey | HVZUDQZUCMHQJZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|