C19H26N2O2 — CID 111425971
N-(2-cyclopentyl-2-hydroxyethyl)-4-(1H-indol-3-yl)butanamide (PubChem CID 111425971) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-(2-cyclopentyl-2-hydroxyethyl)-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-(2-cyclopentyl-2-hydroxyethyl)-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 111425971 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-(2-cyclopentyl-2-hydroxyethyl)-4-(1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)NCC(O)C1CCCC1 |
| InChI | InChI=1S/C19H26N2O2/c22-18(14-6-1-2-7-14)13-21-19(23)11-5-8-15-12-20-17-10-4-3-9-16(15)17/h3-4,9-10,12,14,18,20,22H,1-2,5-8,11,13H2,(H,21,23) |
| InChIKey | SEEJBVDBSTUXKR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |