C18H22N2O3 — CID 120679084
cis-(1R,3S)-3-[4-(1H-indol-3-yl)butanoylamino]cyclopentane-1-carboxylic acid (PubChem CID 120679084) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is cis-(1R,3S)-3-[4-(1H-indol-3-yl)butanoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[4-(1H-indol-3-yl)butanoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120679084 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | cis-(1R,3S)-3-[4-(1H-indol-3-yl)butanoylamino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C18H22N2O3/c21-17(20-14-9-8-12(10-14)18(22)23)7-3-4-13-11-19-16-6-2-1-5-15(13)16/h1-2,5-6,11-12,14,19H,3-4,7-10H2,(H,20,21)(H,22,23)/t12-,14+/m1/s1 |
| InChIKey | RQLDMDFLYVPXEU-OCCSQVGLSA-N |
| XLogP | 2.86 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |