C23H31N3O2 — CID 109145805
4-N-cyclopentyl-1-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1,4-dicarboxamide (PubChem CID 109145805) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-N-cyclopentyl-1-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-cyclopentyl-1-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109145805 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 4-N-cyclopentyl-1-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C1CCC(C(=O)NC2CCCC2)CC1 |
| InChI | InChI=1S/C23H31N3O2/c27-22(24-14-13-18-15-25-21-8-4-3-7-20(18)21)16-9-11-17(12-10-16)23(28)26-19-5-1-2-6-19/h3-4,7-8,15-17,19,25H,1-2,5-6,9-14H2,(H,24,27)(H,26,28) |
| InChIKey | HUERLTVDVXZICS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |