C20H25N3O2 — CID 109132031
1-N-cyclopentyl-2-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109132031) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-N-cyclopentyl-2-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-cyclopentyl-2-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132031 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-N-cyclopentyl-2-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C1CC1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H25N3O2/c24-19(16-11-17(16)20(25)23-14-5-1-2-6-14)21-10-9-13-12-22-18-8-4-3-7-15(13)18/h3-4,7-8,12,14,16-17,22H,1-2,5-6,9-11H2,(H,21,24)(H,23,25) |
| InChIKey | GQNAVKXELZRBSG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |