C22H23N3O2 — CID 109134996
1-N-benzyl-2-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109134996) has the molecular formula C22H23N3O2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-N-benzyl-2-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-benzyl-2-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109134996 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-N-benzyl-2-N-[2-(1H-indol-3-yl)ethyl]cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C1CC1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H23N3O2/c26-21(23-11-10-16-14-24-20-9-5-4-8-17(16)20)18-12-19(18)22(27)25-13-15-6-2-1-3-7-15/h1-9,14,18-19,24H,10-13H2,(H,23,26)(H,25,27) |
| InChIKey | HNGADJFWUZHNKK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |