C22H31N3O2 — CID 109145446
4-N-butan-2-yl-1-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1,4-dicarboxamide (PubChem CID 109145446) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-N-butan-2-yl-1-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-butan-2-yl-1-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109145446 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 4-N-butan-2-yl-1-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1,4-dicarboxamide |
| SMILES | CCC(C)NC(=O)C1CCC(C(=O)NCCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C22H31N3O2/c1-3-15(2)25-22(27)17-10-8-16(9-11-17)21(26)23-13-12-18-14-24-20-7-5-4-6-19(18)20/h4-7,14-17,24H,3,8-13H2,1-2H3,(H,23,26)(H,25,27) |
| InChIKey | VMNSBXPCHOKVQG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |