C27H40N4O3 — CID 69323257
N-[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-1,8-dioxodecan-2-yl]-1-methylpiperidine-4-carboxamide (PubChem CID 69323257) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is N-[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-1,8-dioxodecan-2-yl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-1,8-dioxodecan-2-yl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 69323257 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | N-[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-1,8-dioxodecan-2-yl]-1-methylpiperidine-4-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C1CCN(C)CC1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H40N4O3/c1-3-22(32)9-5-4-6-12-25(30-26(33)20-14-17-31(2)18-15-20)27(34)28-16-13-21-19-29-24-11-8-7-10-23(21)24/h7-8,10-11,19-20,25,29H,3-6,9,12-18H2,1-2H3,(H,28,34)(H,30,33)/t25-/m0/s1 |
| InChIKey | QOAHXAKQYKIGKF-VWLOTQADSA-N |
| XLogP | 3.58 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|