C24H29N3O3 — CID 178135953
benzyl N-[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-1-oxohexan-2-yl]carbamate (PubChem CID 178135953) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 178135953 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | benzyl N-[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-1-oxohexan-2-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OCc1ccccc1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H29N3O3/c1-2-3-12-22(27-24(29)30-17-18-9-5-4-6-10-18)23(28)25-15-14-19-16-26-21-13-8-7-11-20(19)21/h4-11,13,16,22,26H,2-3,12,14-15,17H2,1H3,(H,25,28)(H,27,29)/t22-/m0/s1 |
| InChIKey | RHLPOMQKHJDUEC-QFIPXVFZSA-N |
| XLogP | 4.31 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |