C23H26N4O2 — CID 26710672
4-N-[2-(1H-indol-3-yl)ethyl]-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 26710672) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-N-[2-(1H-indol-3-yl)ethyl]-1-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-[2-(1H-indol-3-yl)ethyl]-1-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 26710672 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 4-N-[2-(1H-indol-3-yl)ethyl]-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N4O2/c28-22(24-13-10-18-16-25-21-9-5-4-8-20(18)21)17-11-14-27(15-12-17)23(29)26-19-6-2-1-3-7-19/h1-9,16-17,25H,10-15H2,(H,24,28)(H,26,29) |
| InChIKey | SRWLAZBRJCWVPW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |