C23H26N4O2 — CID 40972160
(3S)-3-N-[2-(1H-indol-3-yl)ethyl]-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 40972160) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (3S)-3-N-[2-(1H-indol-3-yl)ethyl]-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-[2-(1H-indol-3-yl)ethyl]-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 40972160 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (3S)-3-N-[2-(1H-indol-3-yl)ethyl]-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)[C@H]1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C23H26N4O2/c28-22(24-13-12-17-15-25-21-11-5-4-10-20(17)21)18-7-6-14-27(16-18)23(29)26-19-8-2-1-3-9-19/h1-5,8-11,15,18,25H,6-7,12-14,16H2,(H,24,28)(H,26,29)/t18-/m0/s1 |
| InChIKey | UVTFHKAPLSKSCP-SFHVURJKSA-N |
| XLogP | 3.77 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |