C18H23N3O3 — CID 122001294
1-[3-(1H-indol-3-yl)propylcarbamoyl]piperidine-3-carboxylic acid (PubChem CID 122001294) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)propylcarbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[3-(1H-indol-3-yl)propylcarbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122001294 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)propylcarbamoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)NCCCc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C18H23N3O3/c22-17(23)14-6-4-10-21(12-14)18(24)19-9-3-5-13-11-20-16-8-2-1-7-15(13)16/h1-2,7-8,11,14,20H,3-6,9-10,12H2,(H,19,24)(H,22,23) |
| InChIKey | VZGBOIULICJQMR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|