C22H22N2O2 — CID 110394484
1-(3-benzoylpiperidin-1-yl)-2-(1H-indol-3-yl)ethanone (PubChem CID 110394484) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-(3-benzoylpiperidin-1-yl)-2-(1H-indol-3-yl)ethanone.
| Compound Name | 1-(3-benzoylpiperidin-1-yl)-2-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 110394484 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-(3-benzoylpiperidin-1-yl)-2-(1H-indol-3-yl)ethanone |
| SMILES | O=C(c1ccccc1)C1CCCN(C(=O)Cc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C22H22N2O2/c25-21(13-18-14-23-20-11-5-4-10-19(18)20)24-12-6-9-17(15-24)22(26)16-7-2-1-3-8-16/h1-5,7-8,10-11,14,17,23H,6,9,12-13,15H2 |
| InChIKey | QEHGIDCSGJWJFH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |