C19H25N3O — CID 95712165
2-(1H-indol-3-yl)-1-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]ethanone (PubChem CID 95712165) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]ethanone.
| Compound Name | 2-(1H-indol-3-yl)-1-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95712165 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]ethanone |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CCC[C@@H](N2CCCC2)C1 |
| InChI | InChI=1S/C19H25N3O/c23-19(12-15-13-20-18-8-2-1-7-17(15)18)22-11-5-6-16(14-22)21-9-3-4-10-21/h1-2,7-8,13,16,20H,3-6,9-12,14H2/t16-/m1/s1 |
| InChIKey | GCKKEVTZMXOCGB-MRXNPFEDSA-N |
| XLogP | 2.80 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |