C23H24ClN3O2 — CID 40899994
(3S)-N-[(2-chlorophenyl)methyl]-1-[2-(1H-indol-3-yl)acetyl]piperidine-3-carboxamide (PubChem CID 40899994) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is (3S)-N-[(2-chlorophenyl)methyl]-1-[2-(1H-indol-3-yl)acetyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(2-chlorophenyl)methyl]-1-[2-(1H-indol-3-yl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 40899994 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (3S)-N-[(2-chlorophenyl)methyl]-1-[2-(1H-indol-3-yl)acetyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)[C@H]1CCCN(C(=O)Cc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C23H24ClN3O2/c24-20-9-3-1-6-16(20)13-26-23(29)17-7-5-11-27(15-17)22(28)12-18-14-25-21-10-4-2-8-19(18)21/h1-4,6,8-10,14,17,25H,5,7,11-13,15H2,(H,26,29)/t17-/m0/s1 |
| InChIKey | USDWJODYISXKIO-KRWDZBQOSA-N |
| XLogP | 3.92 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |