C25H25ClN2O2 — CID 50803992
N-[(3-chlorophenyl)methyl]-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide (PubChem CID 50803992) has the molecular formula C25H25ClN2O2 and a molecular weight of 420.94 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50803992 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)C1CCCN(C(=O)Cc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C25H25ClN2O2/c26-22-11-3-6-18(14-22)16-27-25(30)21-10-5-13-28(17-21)24(29)15-20-9-4-8-19-7-1-2-12-23(19)20/h1-4,6-9,11-12,14,21H,5,10,13,15-17H2,(H,27,30) |
| InChIKey | HSHDKAMZHLGLJX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |