C26H28N2O3 — CID 94082698
(3R)-N-[(2-methoxyphenyl)methyl]-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide (PubChem CID 94082698) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is (3R)-N-[(2-methoxyphenyl)methyl]-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[(2-methoxyphenyl)methyl]-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94082698 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (3R)-N-[(2-methoxyphenyl)methyl]-1-(2-naphthalen-1-ylacetyl)piperidine-3-carboxamide |
| SMILES | COc1ccccc1CNC(=O)[C@@H]1CCCN(C(=O)Cc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C26H28N2O3/c1-31-24-14-5-3-9-21(24)17-27-26(30)22-12-7-15-28(18-22)25(29)16-20-11-6-10-19-8-2-4-13-23(19)20/h2-6,8-11,13-14,22H,7,12,15-18H2,1H3,(H,27,30)/t22-/m1/s1 |
| InChIKey | BSHMJHNROWWFQM-JOCHJYFZSA-N |
| XLogP | 3.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |