C27H30N2O2 — CID 94082667
(3S)-1-(2-naphthalen-1-ylacetyl)-N-(3-phenylpropyl)piperidine-3-carboxamide (PubChem CID 94082667) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (3S)-1-(2-naphthalen-1-ylacetyl)-N-(3-phenylpropyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2-naphthalen-1-ylacetyl)-N-(3-phenylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94082667 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (3S)-1-(2-naphthalen-1-ylacetyl)-N-(3-phenylpropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@H]1CCCN(C(=O)Cc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C27H30N2O2/c30-26(19-23-14-6-13-22-12-4-5-16-25(22)23)29-18-8-15-24(20-29)27(31)28-17-7-11-21-9-2-1-3-10-21/h1-6,9-10,12-14,16,24H,7-8,11,15,17-20H2,(H,28,31)/t24-/m0/s1 |
| InChIKey | ZIGRLSYOFURDAH-DEOSSOPVSA-N |
| XLogP | 4.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|