C24H27N3O4 — CID 42649593
N-(2,5-dimethoxyphenyl)-1-[2-(1H-indol-3-yl)acetyl]piperidine-3-carboxamide (PubChem CID 42649593) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-1-[2-(1H-indol-3-yl)acetyl]piperidine-3-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-1-[2-(1H-indol-3-yl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42649593 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-1-[2-(1H-indol-3-yl)acetyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2CCCN(C(=O)Cc3c[nH]c4ccccc34)C2)c1 |
| InChI | InChI=1S/C24H27N3O4/c1-30-18-9-10-22(31-2)21(13-18)26-24(29)16-6-5-11-27(15-16)23(28)12-17-14-25-20-8-4-3-7-19(17)20/h3-4,7-10,13-14,16,25H,5-6,11-12,15H2,1-2H3,(H,26,29) |
| InChIKey | JQRNXEIYXFQOCG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |