C24H29N3O5S — CID 55608281
N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 55608281) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55608281 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CC2)cc1NC(=O)C1CCCN(C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H29N3O5S/c1-32-22-12-11-20(33(30,31)26-19-9-10-19)15-21(22)25-24(29)18-8-5-13-27(16-18)23(28)14-17-6-3-2-4-7-17/h2-4,6-7,11-12,15,18-19,26H,5,8-10,13-14,16H2,1H3,(H,25,29) |
| InChIKey | BXEMCRXSNODBAO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |