C24H29N3O5 — CID 46407957
N'-(4-ethoxy-3-methoxybenzoyl)-1-(2-phenylacetyl)piperidine-3-carbohydrazide (PubChem CID 46407957) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is N'-(4-ethoxy-3-methoxybenzoyl)-1-(2-phenylacetyl)piperidine-3-carbohydrazide.
| Compound Name | N'-(4-ethoxy-3-methoxybenzoyl)-1-(2-phenylacetyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 46407957 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N'-(4-ethoxy-3-methoxybenzoyl)-1-(2-phenylacetyl)piperidine-3-carbohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)C2CCCN(C(=O)Cc3ccccc3)C2)cc1OC |
| InChI | InChI=1S/C24H29N3O5/c1-3-32-20-12-11-18(15-21(20)31-2)23(29)25-26-24(30)19-10-7-13-27(16-19)22(28)14-17-8-5-4-6-9-17/h4-6,8-9,11-12,15,19H,3,7,10,13-14,16H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | JEDOLWOJRGFGHS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|